Guest

BALANCED EQUATION FOR FE2(SO4)(NH4)2.6H20+(COOH)2 GIVES RISE TO

BALANCED EQUATION FOR FE2(SO4)(NH4)2.6H20+(COOH)2 GIVES RISE TO
 

Grade:11

1 Answers

Vikas TU
14149 Points
5 years ago
Balanced reacction for the goven reaction would be:
Fe(NH4)2(SO4)26H2O(s) + H2C2O4(aq)--> 

FeC2O42H2O(s) + (NH4)2SO4(aq) + H2SO4(aq) + 4 H2O(l) 

Think You Can Provide A Better Answer ?